estherpolupan31 estherpolupan31

24-01-2021
English

contestada

What groups are affected by racial justice? And what groups are affected by voting rights?

Respuesta :

laceyjett laceyjett

26-01-2021

Answer:

People affected by racial justice are black people

Explanation:

and the people under 18 are not able to vote and back then that was the same for women.

Answer Link

Otras preguntas

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

My friends and I are sharing a candy bar. I got 1/4 of the candy bar, and my friend Abby got 1/4 of it. How much is left?

solve the system of equations

What is history? Has that meaning changed over time or largely remained the same? Does it differ in different regions of the world? Think of a single example fo

Tom Watson’s beliefs changed over time, and he began to supportbusiness and industry.desegregation.white supremacy.women’s rights.

How many dependent clauses does this sentence have? My father cooked spaghetti for dinner, and I made the salad and garlic bread.

HELPPPPPPPPPPP PLSSSS

Can someone help please?

"Everyone has to follow safety measures while using householdappliances." Justify this statement

A 7 percent increase from 20,100 is ?