masifnajaf9f51274 masifnajaf9f51274

23-05-2021
Chemistry

contestada

How many litres of 15% (mass/ volume) copper sulphate solution
would take to get 75g of copper sulphate ?

Respuesta :

Аноним Аноним

23-05-2021

Take 15/100 X 75 = The answer

Answer Link

madisonrobnett668 madisonrobnett668

26-05-2021

Answer:

dude dont answer my questions dude fucsk you

Answer Link

Otras preguntas

How might convection currents cause plate movement

1. — 7 = 7х + 21 Slop and y intercept

How does industrial education affect industries?

tion A. Classworkall and write the correct answer as quickly as possible1) What should be added to both sides of 13 w got the value) What should be subtracted f

Billy bought 59+45.87+131.39 how much did he spend .

External forces such as extreme weather pose a constant threat to the structural reliability of structures

Which of the following would have the greatest impact on curbing immigration into the United States?

After how many months will workout 24 and your gym cost the same anount

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

Find the density of a substance that has a volume of 754 cm3 and a mass of 7,917 grams.